C36H52N4O8Si — CID 58117340
tert-butyl 2-[5-methoxycarbonyl-2-oxo-1-(2-trimethylsilylethoxymethyl)-3-pyridinyl]-5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]indole-1-carboxylate (PubChem CID 58117340) has the molecular formula C36H52N4O8Si and a molecular weight of 696.92 g/mol. Its IUPAC name is tert-butyl 2-[5-methoxycarbonyl-2-oxo-1-(2-trimethylsilylethoxymethyl)-3-pyridinyl]-5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-[5-methoxycarbonyl-2-oxo-1-(2-trimethylsilylethoxymethyl)-3-pyridinyl]-5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 58117340 |
| Molecular Formula | C36H52N4O8Si |
| Molecular Weight | 696.92 g/mol |
| Exact Mass | 696.36 |
| IUPAC Name | tert-butyl 2-[5-methoxycarbonyl-2-oxo-1-(2-trimethylsilylethoxymethyl)-3-pyridinyl]-5-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]indole-1-carboxylate |
| SMILES | COC(=O)c1cc(-c2cc3cc(CN4CCN(C(=O)OC(C)(C)C)CC4)ccc3n2C(=O)OC(C)(C)C)c(=O)n(COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C36H52N4O8Si/c1-35(2,3)47-33(43)38-15-13-37(14-16-38)22-25-11-12-29-26(19-25)21-30(40(29)34(44)48-36(4,5)6)28-20-27(32(42)45-7)23-39(31(28)41)24-46-17-18-49(8,9)10/h11-12,19-21,23H,13-18,22,24H2,1-10H3 |
| InChIKey | NPVFGFPKLGOOLL-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 121.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|