C35H47F3N4O7SSi — CID 87486858
tert-butyl 5-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]methyl]-2-[3-oxo-7-(trifluoromethylsulfonyloxy)-1,2-dihydroisoindol-4-yl]indole-1-carboxylate (PubChem CID 87486858) has the molecular formula C35H47F3N4O7SSi and a molecular weight of 752.93 g/mol. Its IUPAC name is tert-butyl 5-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]methyl]-2-[3-oxo-7-(trifluoromethylsulfonyloxy)-1,2-dihydroisoindol-4-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 5-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]methyl]-2-[3-oxo-7-(trifluoromethylsulfonyloxy)-1,2-dihydroisoindol-4-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 87486858 |
| Molecular Formula | C35H47F3N4O7SSi |
| Molecular Weight | 752.93 g/mol |
| Exact Mass | 752.29 |
| IUPAC Name | tert-butyl 5-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]methyl]-2-[3-oxo-7-(trifluoromethylsulfonyloxy)-1,2-dihydroisoindol-4-yl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccc(OS(=O)(=O)C(F)(F)F)c3c2C(=O)NC3)cc2cc(CN3CCN(CCO[Si](C)(C)C(C)(C)C)CC3)ccc21 |
| InChI | InChI=1S/C35H47F3N4O7SSi/c1-33(2,3)48-32(44)42-27-11-9-23(22-41-15-13-40(14-16-41)17-18-47-51(7,8)34(4,5)6)19-24(27)20-28(42)25-10-12-29(26-21-39-31(43)30(25)26)49-50(45,46)35(36,37)38/h9-12,19-20H,13-18,21-22H2,1-8H3,(H,39,43) |
| InChIKey | IAZOVOXFMRAHAU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.93 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|