C33H33Cl2N3O6S — CID 86628252
tert-butyl 2-[7-(2,3-dichlorophenyl)sulfonyloxy-3-oxo-1,2-dihydroisoindol-4-yl]-5-(piperidin-1-ylmethyl)indole-1-carboxylate (PubChem CID 86628252) has the molecular formula C33H33Cl2N3O6S and a molecular weight of 670.62 g/mol. Its IUPAC name is tert-butyl 2-[7-(2,3-dichlorophenyl)sulfonyloxy-3-oxo-1,2-dihydroisoindol-4-yl]-5-(piperidin-1-ylmethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-[7-(2,3-dichlorophenyl)sulfonyloxy-3-oxo-1,2-dihydroisoindol-4-yl]-5-(piperidin-1-ylmethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 86628252 |
| Molecular Formula | C33H33Cl2N3O6S |
| Molecular Weight | 670.62 g/mol |
| Exact Mass | 669.15 |
| IUPAC Name | tert-butyl 2-[7-(2,3-dichlorophenyl)sulfonyloxy-3-oxo-1,2-dihydroisoindol-4-yl]-5-(piperidin-1-ylmethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccc(OS(=O)(=O)c3cccc(Cl)c3Cl)c3c2C(=O)NC3)cc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C33H33Cl2N3O6S/c1-33(2,3)43-32(40)38-25-12-10-20(19-37-14-5-4-6-15-37)16-21(25)17-26(38)22-11-13-27(23-18-36-31(39)29(22)23)44-45(41,42)28-9-7-8-24(34)30(28)35/h7-13,16-17H,4-6,14-15,18-19H2,1-3H3,(H,36,39) |
| InChIKey | XQMUNMNDSKWFSG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.62 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|