C36H36N4O6S — CID 86628270
tert-butyl 2-(3-oxo-7-quinolin-8-ylsulfonyloxy-1,2-dihydroisoindol-4-yl)-5-(piperidin-1-ylmethyl)indole-1-carboxylate (PubChem CID 86628270) has the molecular formula C36H36N4O6S and a molecular weight of 652.77 g/mol. Its IUPAC name is tert-butyl 2-(3-oxo-7-quinolin-8-ylsulfonyloxy-1,2-dihydroisoindol-4-yl)-5-(piperidin-1-ylmethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-(3-oxo-7-quinolin-8-ylsulfonyloxy-1,2-dihydroisoindol-4-yl)-5-(piperidin-1-ylmethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 86628270 |
| Molecular Formula | C36H36N4O6S |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | tert-butyl 2-(3-oxo-7-quinolin-8-ylsulfonyloxy-1,2-dihydroisoindol-4-yl)-5-(piperidin-1-ylmethyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccc(OS(=O)(=O)c3cccc4cccnc34)c3c2C(=O)NC3)cc2cc(CN3CCCCC3)ccc21 |
| InChI | InChI=1S/C36H36N4O6S/c1-36(2,3)45-35(42)40-28-14-12-23(22-39-17-5-4-6-18-39)19-25(28)20-29(40)26-13-15-30(27-21-38-34(41)32(26)27)46-47(43,44)31-11-7-9-24-10-8-16-37-33(24)31/h7-16,19-20H,4-6,17-18,21-22H2,1-3H3,(H,38,41) |
| InChIKey | SZTCRQQDULTNQI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|