C30H37N3O6S — CID 86628273
tert-butyl 2-(3-oxo-7-propan-2-ylsulfonyloxy-1,2-dihydroisoindol-4-yl)-5-(piperidin-1-ylmethyl)indole-1-carboxylate (PubChem CID 86628273) has the molecular formula C30H37N3O6S and a molecular weight of 567.71 g/mol. Its IUPAC name is tert-butyl 2-(3-oxo-7-propan-2-ylsulfonyloxy-1,2-dihydroisoindol-4-yl)-5-(piperidin-1-ylmethyl)indole-1-carboxylate.
| Compound Name | tert-butyl 2-(3-oxo-7-propan-2-ylsulfonyloxy-1,2-dihydroisoindol-4-yl)-5-(piperidin-1-ylmethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 86628273 |
| Molecular Formula | C30H37N3O6S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | tert-butyl 2-(3-oxo-7-propan-2-ylsulfonyloxy-1,2-dihydroisoindol-4-yl)-5-(piperidin-1-ylmethyl)indole-1-carboxylate |
| SMILES | CC(C)S(=O)(=O)Oc1ccc(-c2cc3cc(CN4CCCCC4)ccc3n2C(=O)OC(C)(C)C)c2c1CNC2=O |
| InChI | InChI=1S/C30H37N3O6S/c1-19(2)40(36,37)39-26-12-10-22(27-23(26)17-31-28(27)34)25-16-21-15-20(18-32-13-7-6-8-14-32)9-11-24(21)33(25)29(35)38-30(3,4)5/h9-12,15-16,19H,6-8,13-14,17-18H2,1-5H3,(H,31,34) |
| InChIKey | CZRQRQSKPJFHKU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|