C21H33BrN4O3 — CID 163265449
tert-butyl 4-[[2-bromo-6-[(4-hydroxycyclohexyl)amino]-4-pyridinyl]methyl]piperazine-1-carboxylate (PubChem CID 163265449) has the molecular formula C21H33BrN4O3 and a molecular weight of 469.42 g/mol. Its IUPAC name is tert-butyl 4-[[2-bromo-6-[(4-hydroxycyclohexyl)amino]-4-pyridinyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-bromo-6-[(4-hydroxycyclohexyl)amino]-4-pyridinyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163265449 |
| Molecular Formula | C21H33BrN4O3 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | tert-butyl 4-[[2-bromo-6-[(4-hydroxycyclohexyl)amino]-4-pyridinyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2cc(Br)nc(NC3CCC(O)CC3)c2)CC1 |
| InChI | InChI=1S/C21H33BrN4O3/c1-21(2,3)29-20(28)26-10-8-25(9-11-26)14-15-12-18(22)24-19(13-15)23-16-4-6-17(27)7-5-16/h12-13,16-17,27H,4-11,14H2,1-3H3,(H,23,24) |
| InChIKey | UZCKWZDHOZUUQO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|