C16H24BrN3O — CID 163265461
4-[[6-bromo-4-(pyrrolidin-1-ylmethyl)-2-pyridinyl]amino]cyclohexan-1-ol (PubChem CID 163265461) has the molecular formula C16H24BrN3O and a molecular weight of 354.29 g/mol. Its IUPAC name is 4-[[6-bromo-4-(pyrrolidin-1-ylmethyl)-2-pyridinyl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-bromo-4-(pyrrolidin-1-ylmethyl)-2-pyridinyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 163265461 |
| Molecular Formula | C16H24BrN3O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[[6-bromo-4-(pyrrolidin-1-ylmethyl)-2-pyridinyl]amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2cc(CN3CCCC3)cc(Br)n2)CC1 |
| InChI | InChI=1S/C16H24BrN3O/c17-15-9-12(11-20-7-1-2-8-20)10-16(19-15)18-13-3-5-14(21)6-4-13/h9-10,13-14,21H,1-8,11H2,(H,18,19) |
| InChIKey | FRZHZFQAVDGIOD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|