C22H33BrN4O3Si — CID 141466932
tert-butyl 4-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 141466932) has the molecular formula C22H33BrN4O3Si and a molecular weight of 509.52 g/mol. Its IUPAC name is tert-butyl 4-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 141466932 |
| Molecular Formula | C22H33BrN4O3Si |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | tert-butyl 4-[2-bromo-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2cn(COCC[Si](C)(C)C)c3ncc(Br)nc23)CC1 |
| InChI | InChI=1S/C22H33BrN4O3Si/c1-22(2,3)30-21(28)26-9-7-16(8-10-26)17-14-27(15-29-11-12-31(4,5)6)20-19(17)25-18(23)13-24-20/h7,13-14H,8-12,15H2,1-6H3 |
| InChIKey | FYCABLJUQPZCKT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|