C42H35N5O3 — CID 146546740
2-[4-[4-[3-(6-methyl-2-pyridinyl)-1-tritylpyrazol-4-yl]-2-pyridinyl]phenoxy]ethyl carbamate (PubChem CID 146546740) has the molecular formula C42H35N5O3 and a molecular weight of 657.77 g/mol. Its IUPAC name is 2-[4-[4-[3-(6-methyl-2-pyridinyl)-1-tritylpyrazol-4-yl]-2-pyridinyl]phenoxy]ethyl carbamate.
| Compound Name | 2-[4-[4-[3-(6-methyl-2-pyridinyl)-1-tritylpyrazol-4-yl]-2-pyridinyl]phenoxy]ethyl carbamate |
|---|---|
| PubChem CID | 146546740 |
| Molecular Formula | C42H35N5O3 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | 2-[4-[4-[3-(6-methyl-2-pyridinyl)-1-tritylpyrazol-4-yl]-2-pyridinyl]phenoxy]ethyl carbamate |
| SMILES | Cc1cccc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2-c2ccnc(-c3ccc(OCCOC(N)=O)cc3)c2)n1 |
| InChI | InChI=1S/C42H35N5O3/c1-30-12-11-19-38(45-30)40-37(32-24-25-44-39(28-32)31-20-22-36(23-21-31)49-26-27-50-41(43)48)29-47(46-40)42(33-13-5-2-6-14-33,34-15-7-3-8-16-34)35-17-9-4-10-18-35/h2-25,28-29H,26-27H2,1H3,(H2,43,48) |
| InChIKey | ZQHCZQLKVILGGK-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|