C39H42N2O3 — CID 153309710
1-[8-[4-[2,3,5,6-tetramethyl-4-(2-phenyl-4-pyridinyl)phenyl]phenoxy]octyl]pyrrole-2,5-dione (PubChem CID 153309710) has the molecular formula C39H42N2O3 and a molecular weight of 586.78 g/mol. Its IUPAC name is 1-[8-[4-[2,3,5,6-tetramethyl-4-(2-phenyl-4-pyridinyl)phenyl]phenoxy]octyl]pyrrole-2,5-dione.
| Compound Name | 1-[8-[4-[2,3,5,6-tetramethyl-4-(2-phenyl-4-pyridinyl)phenyl]phenoxy]octyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 153309710 |
| Molecular Formula | C39H42N2O3 |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | 1-[8-[4-[2,3,5,6-tetramethyl-4-(2-phenyl-4-pyridinyl)phenyl]phenoxy]octyl]pyrrole-2,5-dione |
| SMILES | Cc1c(C)c(-c2ccnc(-c3ccccc3)c2)c(C)c(C)c1-c1ccc(OCCCCCCCCN2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C39H42N2O3/c1-27-29(3)39(33-22-23-40-35(26-33)31-14-10-9-11-15-31)30(4)28(2)38(27)32-16-18-34(19-17-32)44-25-13-8-6-5-7-12-24-41-36(42)20-21-37(41)43/h9-11,14-23,26H,5-8,12-13,24-25H2,1-4H3 |
| InChIKey | FXWUUWUHFGLYPL-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|