C33H38N2O3 — CID 139975988
1-[6-[4-[6-(4-hexylphenyl)-3-pyridinyl]phenoxy]hexyl]pyrrole-2,5-dione (PubChem CID 139975988) has the molecular formula C33H38N2O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is 1-[6-[4-[6-(4-hexylphenyl)-3-pyridinyl]phenoxy]hexyl]pyrrole-2,5-dione.
| Compound Name | 1-[6-[4-[6-(4-hexylphenyl)-3-pyridinyl]phenoxy]hexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139975988 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 1-[6-[4-[6-(4-hexylphenyl)-3-pyridinyl]phenoxy]hexyl]pyrrole-2,5-dione |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(OCCCCCCN4C(=O)C=CC4=O)cc3)cn2)cc1 |
| InChI | InChI=1S/C33H38N2O3/c1-2-3-4-7-10-26-11-13-28(14-12-26)31-20-17-29(25-34-31)27-15-18-30(19-16-27)38-24-9-6-5-8-23-35-32(36)21-22-33(35)37/h11-22,25H,2-10,23-24H2,1H3 |
| InChIKey | BRFSOCXBVWUFSX-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|