C44H36N2 — CID 58692905
4-[4-(2,6-diphenyl-4-pyridinyl)-2,3,5,6-tetramethylphenyl]-2,6-diphenylpyridine (PubChem CID 58692905) has the molecular formula C44H36N2 and a molecular weight of 592.79 g/mol. Its IUPAC name is 4-[4-(2,6-diphenyl-4-pyridinyl)-2,3,5,6-tetramethylphenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[4-(2,6-diphenyl-4-pyridinyl)-2,3,5,6-tetramethylphenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 58692905 |
| Molecular Formula | C44H36N2 |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | 4-[4-(2,6-diphenyl-4-pyridinyl)-2,3,5,6-tetramethylphenyl]-2,6-diphenylpyridine |
| SMILES | Cc1c(C)c(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)c(C)c(C)c1-c1cc(-c2ccccc2)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C44H36N2/c1-29-30(2)44(38-27-41(35-21-13-7-14-22-35)46-42(28-38)36-23-15-8-16-24-36)32(4)31(3)43(29)37-25-39(33-17-9-5-10-18-33)45-40(26-37)34-19-11-6-12-20-34/h5-28H,1-4H3 |
| InChIKey | GZNKEMQCUYVGNL-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |