C23H15Cl2N — CID 139203314
4-(2,6-dichlorophenyl)-2,6-diphenylpyridine (PubChem CID 139203314) has the molecular formula C23H15Cl2N and a molecular weight of 376.29 g/mol. Its IUPAC name is 4-(2,6-dichlorophenyl)-2,6-diphenylpyridine.
| Compound Name | 4-(2,6-dichlorophenyl)-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 139203314 |
| Molecular Formula | C23H15Cl2N |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 4-(2,6-dichlorophenyl)-2,6-diphenylpyridine |
| SMILES | Clc1cccc(Cl)c1-c1cc(-c2ccccc2)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H15Cl2N/c24-19-12-7-13-20(25)23(19)18-14-21(16-8-3-1-4-9-16)26-22(15-18)17-10-5-2-6-11-17/h1-15H |
| InChIKey | PGVNNNNGCPHWGV-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |