C47H34N2 — CID 58692950
4-[3-(2,6-diphenyl-4-pyridinyl)-2-methyl-5-phenylphenyl]-2,6-diphenylpyridine (PubChem CID 58692950) has the molecular formula C47H34N2 and a molecular weight of 626.80 g/mol. Its IUPAC name is 4-[3-(2,6-diphenyl-4-pyridinyl)-2-methyl-5-phenylphenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[3-(2,6-diphenyl-4-pyridinyl)-2-methyl-5-phenylphenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 58692950 |
| Molecular Formula | C47H34N2 |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 4-[3-(2,6-diphenyl-4-pyridinyl)-2-methyl-5-phenylphenyl]-2,6-diphenylpyridine |
| SMILES | Cc1c(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc(-c2ccccc2)cc1-c1cc(-c2ccccc2)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C47H34N2/c1-33-42(40-29-44(35-19-9-3-10-20-35)48-45(30-40)36-21-11-4-12-22-36)27-39(34-17-7-2-8-18-34)28-43(33)41-31-46(37-23-13-5-14-24-37)49-47(32-41)38-25-15-6-16-26-38/h2-32H,1H3 |
| InChIKey | QMHOHTWNUCXUEN-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |