C34H33NO3 — CID 150003736
5-[4-[(E)-2-[4-(2-phenyl-4-pyridinyl)phenyl]ethenyl]phenoxy]pentyl 2-methylprop-2-enoate (PubChem CID 150003736) has the molecular formula C34H33NO3 and a molecular weight of 503.64 g/mol. Its IUPAC name is 5-[4-[(E)-2-[4-(2-phenyl-4-pyridinyl)phenyl]ethenyl]phenoxy]pentyl 2-methylprop-2-enoate.
| Compound Name | 5-[4-[(E)-2-[4-(2-phenyl-4-pyridinyl)phenyl]ethenyl]phenoxy]pentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150003736 |
| Molecular Formula | C34H33NO3 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 5-[4-[(E)-2-[4-(2-phenyl-4-pyridinyl)phenyl]ethenyl]phenoxy]pentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCOc1ccc(/C=C/c2ccc(-c3ccnc(-c4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C34H33NO3/c1-26(2)34(36)38-24-8-4-7-23-37-32-19-15-28(16-20-32)12-11-27-13-17-29(18-14-27)31-21-22-35-33(25-31)30-9-5-3-6-10-30/h3,5-6,9-22,25H,1,4,7-8,23-24H2,2H3/b12-11+ |
| InChIKey | DBVLOTSWGZGSID-VAWYXSNFSA-N |
| XLogP | 8.25 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|