C19H12F3N5 — CID 140737268
6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine (PubChem CID 140737268) has the molecular formula C19H12F3N5 and a molecular weight of 367.33 g/mol. Its IUPAC name is 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine.
| Compound Name | 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 140737268 |
| Molecular Formula | C19H12F3N5 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 6-[3-(2,2-difluoroethyl)-5-(4-fluorophenyl)imidazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine |
| SMILES | [C-]#[N+]c1cnc2ccc(-c3c(-c4ccc(F)cc4)ncn3CC(F)F)cn12 |
| InChI | InChI=1S/C19H12F3N5/c1-23-17-8-24-16-7-4-13(9-27(16)17)19-18(12-2-5-14(20)6-3-12)25-11-26(19)10-15(21)22/h2-9,11,15H,10H2 |
| InChIKey | SBZBUHUQMNAKED-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 39.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|