C19H13FN6O2 — CID 157297472
6-[3-ethyl-5-(4-fluorophenyl)-2-nitroimidazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine (PubChem CID 157297472) has the molecular formula C19H13FN6O2 and a molecular weight of 376.35 g/mol. Its IUPAC name is 6-[3-ethyl-5-(4-fluorophenyl)-2-nitroimidazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine.
| Compound Name | 6-[3-ethyl-5-(4-fluorophenyl)-2-nitroimidazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 157297472 |
| Molecular Formula | C19H13FN6O2 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 6-[3-ethyl-5-(4-fluorophenyl)-2-nitroimidazol-4-yl]-3-isocyanoimidazo[1,2-a]pyridine |
| SMILES | [C-]#[N+]c1cnc2ccc(-c3c(-c4ccc(F)cc4)nc([N+](=O)[O-])n3CC)cn12 |
| InChI | InChI=1S/C19H13FN6O2/c1-3-24-18(13-6-9-15-22-10-16(21-2)25(15)11-13)17(23-19(24)26(27)28)12-4-7-14(20)8-5-12/h4-11H,3H2,1H3 |
| InChIKey | JNFRKBHPSYCBMO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|