C18H13FN6O — CID 140737385
2-[4-(4-fluorophenyl)-5-(3-isocyanoimidazo[1,2-b]pyridazin-6-yl)imidazol-1-yl]ethanol (PubChem CID 140737385) has the molecular formula C18H13FN6O and a molecular weight of 348.34 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-5-(3-isocyanoimidazo[1,2-b]pyridazin-6-yl)imidazol-1-yl]ethanol.
| Compound Name | 2-[4-(4-fluorophenyl)-5-(3-isocyanoimidazo[1,2-b]pyridazin-6-yl)imidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 140737385 |
| Molecular Formula | C18H13FN6O |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-5-(3-isocyanoimidazo[1,2-b]pyridazin-6-yl)imidazol-1-yl]ethanol |
| SMILES | [C-]#[N+]c1cnc2ccc(-c3c(-c4ccc(F)cc4)ncn3CCO)nn12 |
| InChI | InChI=1S/C18H13FN6O/c1-20-16-10-21-15-7-6-14(23-25(15)16)18-17(22-11-24(18)8-9-26)12-2-4-13(19)5-3-12/h2-7,10-11,26H,8-9H2 |
| InChIKey | GVWZRKKTAAZMFD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|