C20H29BrFN3O2SSi — CID 67504903
N-[[3-(2-bromo-5-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 67504903) has the molecular formula C20H29BrFN3O2SSi and a molecular weight of 502.53 g/mol. Its IUPAC name is N-[[3-(2-bromo-5-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[[3-(2-bromo-5-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67504903 |
| Molecular Formula | C20H29BrFN3O2SSi |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | N-[[3-(2-bromo-5-fluorophenyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=Cc1cn(COCC[Si](C)(C)C)nc1-c1cc(F)ccc1Br |
| InChI | InChI=1S/C20H29BrFN3O2SSi/c1-20(2,3)28(26)23-12-15-13-25(14-27-9-10-29(4,5)6)24-19(15)17-11-16(22)7-8-18(17)21/h7-8,11-13H,9-10,14H2,1-6H3 |
| InChIKey | JIPANGIEXUPBIH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|