C17H27N3O2Si — CID 150463736
3-methoxy-4-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]aniline (PubChem CID 150463736) has the molecular formula C17H27N3O2Si and a molecular weight of 333.51 g/mol. Its IUPAC name is 3-methoxy-4-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]aniline.
| Compound Name | 3-methoxy-4-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]aniline |
|---|---|
| PubChem CID | 150463736 |
| Molecular Formula | C17H27N3O2Si |
| Molecular Weight | 333.51 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-methoxy-4-[3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]aniline |
| SMILES | COc1cc(N)ccc1-c1cn(COCC[Si](C)(C)C)nc1C |
| InChI | InChI=1S/C17H27N3O2Si/c1-13-16(15-7-6-14(18)10-17(15)21-2)11-20(19-13)12-22-8-9-23(3,4)5/h6-7,10-11H,8-9,12,18H2,1-5H3 |
| InChIKey | HQHWPJCVXCCJDQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|