C11H14N4O — CID 82472146
4-(2,5-dimethyl-1,2,4-triazol-3-yl)-3-methoxyaniline (PubChem CID 82472146) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1,2,4-triazol-3-yl)-3-methoxyaniline.
| Compound Name | 4-(2,5-dimethyl-1,2,4-triazol-3-yl)-3-methoxyaniline |
|---|---|
| PubChem CID | 82472146 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-(2,5-dimethyl-1,2,4-triazol-3-yl)-3-methoxyaniline |
| SMILES | COc1cc(N)ccc1-c1nc(C)nn1C |
| InChI | InChI=1S/C11H14N4O/c1-7-13-11(15(2)14-7)9-5-4-8(12)6-10(9)16-3/h4-6H,12H2,1-3H3 |
| InChIKey | AKFPOBHWUWNAFH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|