C10H10F3N5O — CID 104784465
3-methoxy-4-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline (PubChem CID 104784465) has the molecular formula C10H10F3N5O and a molecular weight of 273.22 g/mol. Its IUPAC name is 3-methoxy-4-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline.
| Compound Name | 3-methoxy-4-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 104784465 |
| Molecular Formula | C10H10F3N5O |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-methoxy-4-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline |
| SMILES | COc1cc(N)ccc1-c1nnnn1CC(F)(F)F |
| InChI | InChI=1S/C10H10F3N5O/c1-19-8-4-6(14)2-3-7(8)9-15-16-17-18(9)5-10(11,12)13/h2-4H,5,14H2,1H3 |
| InChIKey | FQDZGZSUMYPNFS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|