C11H12F3N5O — CID 63227252
4-methoxy-3-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline (PubChem CID 63227252) has the molecular formula C11H12F3N5O and a molecular weight of 287.25 g/mol. Its IUPAC name is 4-methoxy-3-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline.
| Compound Name | 4-methoxy-3-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 63227252 |
| Molecular Formula | C11H12F3N5O |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-methoxy-3-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline |
| SMILES | COc1ccc(N)cc1-c1nnnn1CCC(F)(F)F |
| InChI | InChI=1S/C11H12F3N5O/c1-20-9-3-2-7(15)6-8(9)10-16-17-18-19(10)5-4-11(12,13)14/h2-3,6H,4-5,15H2,1H3 |
| InChIKey | HDRPIPNDZDHTTL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|