C9H9F3N6 — CID 61352878
4-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]benzene-1,3-diamine (PubChem CID 61352878) has the molecular formula C9H9F3N6 and a molecular weight of 258.21 g/mol. Its IUPAC name is 4-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]benzene-1,3-diamine.
| Compound Name | 4-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 61352878 |
| Molecular Formula | C9H9F3N6 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]benzene-1,3-diamine |
| SMILES | Nc1ccc(-c2nnnn2CC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C9H9F3N6/c10-9(11,12)4-18-8(15-16-17-18)6-2-1-5(13)3-7(6)14/h1-3H,4,13-14H2 |
| InChIKey | NFMYQVFXXUPCAY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|