C14H13FN6 — CID 61378736
4-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]benzene-1,3-diamine (PubChem CID 61378736) has the molecular formula C14H13FN6 and a molecular weight of 284.30 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]benzene-1,3-diamine.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 61378736 |
| Molecular Formula | C14H13FN6 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]benzene-1,3-diamine |
| SMILES | Nc1ccc(-c2nnnn2Cc2ccc(F)cc2)c(N)c1 |
| InChI | InChI=1S/C14H13FN6/c15-10-3-1-9(2-4-10)8-21-14(18-19-20-21)12-6-5-11(16)7-13(12)17/h1-7H,8,16-17H2 |
| InChIKey | FJPTWZRIPATWFE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|