C10H9BrF3N5 — CID 107873944
5-bromo-2-methyl-3-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline (PubChem CID 107873944) has the molecular formula C10H9BrF3N5 and a molecular weight of 336.12 g/mol. Its IUPAC name is 5-bromo-2-methyl-3-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline.
| Compound Name | 5-bromo-2-methyl-3-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 107873944 |
| Molecular Formula | C10H9BrF3N5 |
| Molecular Weight | 336.12 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 5-bromo-2-methyl-3-[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]aniline |
| SMILES | Cc1c(N)cc(Br)cc1-c1nnnn1CC(F)(F)F |
| InChI | InChI=1S/C10H9BrF3N5/c1-5-7(2-6(11)3-8(5)15)9-16-17-18-19(9)4-10(12,13)14/h2-3H,4,15H2,1H3 |
| InChIKey | SLKAIIXTZAFUGT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.12 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|