C12H13BrF3N5 — CID 107874031
5-bromo-2-methyl-3-[1-(4,4,4-trifluorobutyl)tetrazol-5-yl]aniline (PubChem CID 107874031) has the molecular formula C12H13BrF3N5 and a molecular weight of 364.17 g/mol. Its IUPAC name is 5-bromo-2-methyl-3-[1-(4,4,4-trifluorobutyl)tetrazol-5-yl]aniline.
| Compound Name | 5-bromo-2-methyl-3-[1-(4,4,4-trifluorobutyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 107874031 |
| Molecular Formula | C12H13BrF3N5 |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 5-bromo-2-methyl-3-[1-(4,4,4-trifluorobutyl)tetrazol-5-yl]aniline |
| SMILES | Cc1c(N)cc(Br)cc1-c1nnnn1CCCC(F)(F)F |
| InChI | InChI=1S/C12H13BrF3N5/c1-7-9(5-8(13)6-10(7)17)11-18-19-20-21(11)4-2-3-12(14,15)16/h5-6H,2-4,17H2,1H3 |
| InChIKey | DPIFRNISMZNFKJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|