C12H13F4N5 — CID 103298205
4-fluoro-3-methyl-5-[1-(4,4,4-trifluorobutyl)tetrazol-5-yl]aniline (PubChem CID 103298205) has the molecular formula C12H13F4N5 and a molecular weight of 303.26 g/mol. Its IUPAC name is 4-fluoro-3-methyl-5-[1-(4,4,4-trifluorobutyl)tetrazol-5-yl]aniline.
| Compound Name | 4-fluoro-3-methyl-5-[1-(4,4,4-trifluorobutyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 103298205 |
| Molecular Formula | C12H13F4N5 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-fluoro-3-methyl-5-[1-(4,4,4-trifluorobutyl)tetrazol-5-yl]aniline |
| SMILES | Cc1cc(N)cc(-c2nnnn2CCCC(F)(F)F)c1F |
| InChI | InChI=1S/C12H13F4N5/c1-7-5-8(17)6-9(10(7)13)11-18-19-20-21(11)4-2-3-12(14,15)16/h5-6H,2-4,17H2,1H3 |
| InChIKey | FBBHIASMNFGRNJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|