C10H10F3N5 — CID 55175336
2-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline (PubChem CID 55175336) has the molecular formula C10H10F3N5 and a molecular weight of 257.22 g/mol. Its IUPAC name is 2-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline.
| Compound Name | 2-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 55175336 |
| Molecular Formula | C10H10F3N5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline |
| SMILES | Nc1ccccc1-c1nnnn1CCC(F)(F)F |
| InChI | InChI=1S/C10H10F3N5/c11-10(12,13)5-6-18-9(15-16-17-18)7-3-1-2-4-8(7)14/h1-4H,5-6,14H2 |
| InChIKey | UWYJDAGTQCXIDL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|