C12H16ClN5 — CID 61376438
5-chloro-2-[1-(2,2-dimethylpropyl)tetrazol-5-yl]aniline (PubChem CID 61376438) has the molecular formula C12H16ClN5 and a molecular weight of 265.75 g/mol. Its IUPAC name is 5-chloro-2-[1-(2,2-dimethylpropyl)tetrazol-5-yl]aniline.
| Compound Name | 5-chloro-2-[1-(2,2-dimethylpropyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 61376438 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 5-chloro-2-[1-(2,2-dimethylpropyl)tetrazol-5-yl]aniline |
| SMILES | CC(C)(C)Cn1nnnc1-c1ccc(Cl)cc1N |
| InChI | InChI=1S/C12H16ClN5/c1-12(2,3)7-18-11(15-16-17-18)9-5-4-8(13)6-10(9)14/h4-6H,7,14H2,1-3H3 |
| InChIKey | CANRMGCVWGIHAL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|