C12H14F3N5O — CID 81102447
3-ethoxy-5-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline (PubChem CID 81102447) has the molecular formula C12H14F3N5O and a molecular weight of 301.27 g/mol. Its IUPAC name is 3-ethoxy-5-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline.
| Compound Name | 3-ethoxy-5-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 81102447 |
| Molecular Formula | C12H14F3N5O |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-ethoxy-5-[1-(3,3,3-trifluoropropyl)tetrazol-5-yl]aniline |
| SMILES | CCOc1cc(N)cc(-c2nnnn2CCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N5O/c1-2-21-10-6-8(5-9(16)7-10)11-17-18-19-20(11)4-3-12(13,14)15/h5-7H,2-4,16H2,1H3 |
| InChIKey | CEHUHPHTXAKFNK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|