C34H52N6O6Si2 — CID 165087747
2-[[2-(1,4-dimethylpyrazol-5-yl)-5-nitrophenoxy]methoxy]ethyl-trimethylsilane;4-(1,4-dimethylpyrazol-5-yl)-3-(2-trimethylsilylethoxymethoxy)aniline (PubChem CID 165087747) has the molecular formula C34H52N6O6Si2 and a molecular weight of 697.00 g/mol. Its IUPAC name is 2-[[2-(1,4-dimethylpyrazol-5-yl)-5-nitrophenoxy]methoxy]ethyl-trimethylsilane;4-(1,4-dimethylpyrazol-5-yl)-3-(2-trimethylsilylethoxymethoxy)aniline.
| Compound Name | 2-[[2-(1,4-dimethylpyrazol-5-yl)-5-nitrophenoxy]methoxy]ethyl-trimethylsilane;4-(1,4-dimethylpyrazol-5-yl)-3-(2-trimethylsilylethoxymethoxy)aniline |
|---|---|
| PubChem CID | 165087747 |
| Molecular Formula | C34H52N6O6Si2 |
| Molecular Weight | 697.00 g/mol |
| Exact Mass | 696.35 |
| IUPAC Name | 2-[[2-(1,4-dimethylpyrazol-5-yl)-5-nitrophenoxy]methoxy]ethyl-trimethylsilane;4-(1,4-dimethylpyrazol-5-yl)-3-(2-trimethylsilylethoxymethoxy)aniline |
| SMILES | Cc1cnn(C)c1-c1ccc(N)cc1OCOCC[Si](C)(C)C.Cc1cnn(C)c1-c1ccc([N+](=O)[O-])cc1OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C17H25N3O4Si.C17H27N3O2Si/c1-13-11-18-19(2)17(13)15-7-6-14(20(21)22)10-16(15)24-12-23-8-9-25(3,4)5;1-13-11-19-20(2)17(13)15-7-6-14(18)10-16(15)22-12-21-8-9-23(3,4)5/h6-7,10-11H,8-9,12H2,1-5H3;6-7,10-11H,8-9,12,18H2,1-5H3 |
| InChIKey | WEEWLBVTSKVDJQ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 141.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.00 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|