C10H19ClN2O2Si — CID 171404429
[3-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methanol (PubChem CID 171404429) has the molecular formula C10H19ClN2O2Si and a molecular weight of 262.81 g/mol. Its IUPAC name is [3-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methanol.
| Compound Name | [3-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 171404429 |
| Molecular Formula | C10H19ClN2O2Si |
| Molecular Weight | 262.81 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | [3-chloro-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1cc(CO)c(Cl)n1 |
| InChI | InChI=1S/C10H19ClN2O2Si/c1-16(2,3)5-4-15-8-13-6-9(7-14)10(11)12-13/h6,14H,4-5,7-8H2,1-3H3 |
| InChIKey | NHZSONGHWWOITH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.81 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|