C14H12N2 — CID 57482994
4-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 57482994) has the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 57482994 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-(4-methylphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C14H12N2/c1-10-2-4-11(5-3-10)12-6-8-15-14-13(12)7-9-16-14/h2-9H,1H3,(H,15,16) |
| InChIKey | JNKPFYGHHWTGQG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |