C25H32ClFN4O3SSi — CID 176706718
2-[[5-(2-tert-butyl-1,1-dioxo-3H-1,2-benzothiazol-4-yl)-4-chloro-2-(5-fluoro-2-pyridinyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 176706718) has the molecular formula C25H32ClFN4O3SSi and a molecular weight of 551.16 g/mol. Its IUPAC name is 2-[[5-(2-tert-butyl-1,1-dioxo-3H-1,2-benzothiazol-4-yl)-4-chloro-2-(5-fluoro-2-pyridinyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(2-tert-butyl-1,1-dioxo-3H-1,2-benzothiazol-4-yl)-4-chloro-2-(5-fluoro-2-pyridinyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 176706718 |
| Molecular Formula | C25H32ClFN4O3SSi |
| Molecular Weight | 551.16 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 2-[[5-(2-tert-butyl-1,1-dioxo-3H-1,2-benzothiazol-4-yl)-4-chloro-2-(5-fluoro-2-pyridinyl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(C)(C)N1Cc2c(-c3c(Cl)nc(-c4ccc(F)cn4)n3COCC[Si](C)(C)C)cccc2S1(=O)=O |
| InChI | InChI=1S/C25H32ClFN4O3SSi/c1-25(2,3)31-15-19-18(8-7-9-21(19)35(31,32)33)22-23(26)29-24(20-11-10-17(27)14-28-20)30(22)16-34-12-13-36(4,5)6/h7-11,14H,12-13,15-16H2,1-6H3 |
| InChIKey | GUPRGIDBUNLEMD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.16 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|