About 2-trimethylsilylethyl 2-diazo-2-phenylacetate
2-trimethylsilylethyl 2-diazo-2-phenylacetate (PubChem CID 132605238) has the molecular formula C13H18N2O2Si
and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-diazo-2-phenylacetate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 2-diazo-2-phenylacetate |
| PubChem CID | 132605238 |
| Molecular Formula | C13H18N2O2Si |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-trimethylsilylethyl 2-diazo-2-phenylacetate |
| SMILES | C[Si](C)(C)CCOC(=O)C(=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C13H18N2O2Si/c1-18(2,3)10-9-17-13(16)12(15-14)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | IPZLCYUDFGCHJJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 2-diazo-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 2-diazo-2-phenylacetate?
The IUPAC name of 2-trimethylsilylethyl 2-diazo-2-phenylacetate (CID 132605238) is 2-trimethylsilylethyl 2-diazo-2-phenylacetate.
What is the SMILES notation for 2-trimethylsilylethyl 2-diazo-2-phenylacetate?
The canonical SMILES for 2-trimethylsilylethyl 2-diazo-2-phenylacetate is C[Si](C)(C)CCOC(=O)C(=[N+]=[N-])c1ccccc1.
What is the InChIKey of 2-trimethylsilylethyl 2-diazo-2-phenylacetate?
The InChIKey is IPZLCYUDFGCHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2Si/c1-18(2,3)10-9-17-13(16)12(15-14)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3.
What are the key properties of 2-trimethylsilylethyl 2-diazo-2-phenylacetate?
2-trimethylsilylethyl 2-diazo-2-phenylacetate has a molecular weight of 262.38 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 2-diazo-2-phenylacetate is sourced from PubChem (CID 132605238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).