C37H28N8O8 — CID 176825376
[3-(2-diazo-2-phenylacetyl)oxy-2,2-bis[(2-diazo-2-phenylacetyl)oxymethyl]propyl] 2-diazo-2-phenylacetate (PubChem CID 176825376) has the molecular formula C37H28N8O8 and a molecular weight of 712.68 g/mol. Its IUPAC name is [3-(2-diazo-2-phenylacetyl)oxy-2,2-bis[(2-diazo-2-phenylacetyl)oxymethyl]propyl] 2-diazo-2-phenylacetate.
| Compound Name | [3-(2-diazo-2-phenylacetyl)oxy-2,2-bis[(2-diazo-2-phenylacetyl)oxymethyl]propyl] 2-diazo-2-phenylacetate |
|---|---|
| PubChem CID | 176825376 |
| Molecular Formula | C37H28N8O8 |
| Molecular Weight | 712.68 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | [3-(2-diazo-2-phenylacetyl)oxy-2,2-bis[(2-diazo-2-phenylacetyl)oxymethyl]propyl] 2-diazo-2-phenylacetate |
| SMILES | [N-]=[N+]=C(C(=O)OCC(COC(=O)C(=[N+]=[N-])c1ccccc1)(COC(=O)C(=[N+]=[N-])c1ccccc1)COC(=O)C(=[N+]=[N-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H28N8O8/c38-42-29(25-13-5-1-6-14-25)33(46)50-21-37(22-51-34(47)30(43-39)26-15-7-2-8-16-26,23-52-35(48)31(44-40)27-17-9-3-10-18-27)24-53-36(49)32(45-41)28-19-11-4-12-20-28/h1-20H,21-24H2 |
| InChIKey | YWRMEUZPPMTBRS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 250.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.68 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|