About 2-diazo-N-methyl-N,2-diphenylacetamide
2-diazo-N-methyl-N,2-diphenylacetamide (PubChem CID 57364283) has the molecular formula C15H13N3O
and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-diazo-N-methyl-N,2-diphenylacetamide.
Molecular Properties
| Compound Name | 2-diazo-N-methyl-N,2-diphenylacetamide |
| PubChem CID | 57364283 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-diazo-N-methyl-N,2-diphenylacetamide |
| SMILES | CN(C(=O)C(=[N+]=[N-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13N3O/c1-18(13-10-6-3-7-11-13)15(19)14(17-16)12-8-4-2-5-9-12/h2-11H,1H3 |
| InChIKey | NLIADWGWATWJCY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazo-N-methyl-N,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazo-N-methyl-N,2-diphenylacetamide?
The IUPAC name of 2-diazo-N-methyl-N,2-diphenylacetamide (CID 57364283) is 2-diazo-N-methyl-N,2-diphenylacetamide.
What is the SMILES notation for 2-diazo-N-methyl-N,2-diphenylacetamide?
The canonical SMILES for 2-diazo-N-methyl-N,2-diphenylacetamide is CN(C(=O)C(=[N+]=[N-])c1ccccc1)c1ccccc1.
What is the InChIKey of 2-diazo-N-methyl-N,2-diphenylacetamide?
The InChIKey is NLIADWGWATWJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O/c1-18(13-10-6-3-7-11-13)15(19)14(17-16)12-8-4-2-5-9-12/h2-11H,1H3.
What are the key properties of 2-diazo-N-methyl-N,2-diphenylacetamide?
2-diazo-N-methyl-N,2-diphenylacetamide has a molecular weight of 251.29 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazo-N-methyl-N,2-diphenylacetamide is sourced from PubChem (CID 57364283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).