C11H18N4O3Si — CID 22343067
[5-cyano-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]carbamic acid (PubChem CID 22343067) has the molecular formula C11H18N4O3Si and a molecular weight of 282.38 g/mol. Its IUPAC name is [5-cyano-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]carbamic acid.
| Compound Name | [5-cyano-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]carbamic acid |
|---|---|
| PubChem CID | 22343067 |
| Molecular Formula | C11H18N4O3Si |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [5-cyano-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]carbamic acid |
| SMILES | C[Si](C)(C)CCOCn1cnc(C#N)c1NC(=O)O |
| InChI | InChI=1S/C11H18N4O3Si/c1-19(2,3)5-4-18-8-15-7-13-9(6-12)10(15)14-11(16)17/h7,14H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | VTANNQLSMCNOBN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|