C13H16Cl2N4OSi — CID 86725368
4,6-dichloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridine-7-carbonitrile (PubChem CID 86725368) has the molecular formula C13H16Cl2N4OSi and a molecular weight of 343.29 g/mol. Its IUPAC name is 4,6-dichloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridine-7-carbonitrile.
| Compound Name | 4,6-dichloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 86725368 |
| Molecular Formula | C13H16Cl2N4OSi |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4,6-dichloro-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridine-7-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(Cl)nc(Cl)c(C#N)c21 |
| InChI | InChI=1S/C13H16Cl2N4OSi/c1-21(2,3)5-4-20-8-19-7-17-10-11(19)9(6-16)12(14)18-13(10)15/h7H,4-5,8H2,1-3H3 |
| InChIKey | KYYKDXIURVIHBG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|