C28H32N4O3Si — CID 68845627
4-oxo-5-(3-phenoxypropyl)-6-phenyl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-d]pyrimidine-7-carbonitrile (PubChem CID 68845627) has the molecular formula C28H32N4O3Si and a molecular weight of 500.68 g/mol. Its IUPAC name is 4-oxo-5-(3-phenoxypropyl)-6-phenyl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-d]pyrimidine-7-carbonitrile.
| Compound Name | 4-oxo-5-(3-phenoxypropyl)-6-phenyl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-d]pyrimidine-7-carbonitrile |
|---|---|
| PubChem CID | 68845627 |
| Molecular Formula | C28H32N4O3Si |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 4-oxo-5-(3-phenoxypropyl)-6-phenyl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-d]pyrimidine-7-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(C#N)c(-c3ccccc3)n(CCCOc3ccccc3)c2c1=O |
| InChI | InChI=1S/C28H32N4O3Si/c1-36(2,3)18-17-34-21-31-20-30-25-24(19-29)26(22-11-6-4-7-12-22)32(27(25)28(31)33)15-10-16-35-23-13-8-5-9-14-23/h4-9,11-14,20H,10,15-18,21H2,1-3H3 |
| InChIKey | CCMDXVPLKIUPFY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 82.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|