C20H21Cl3N4OSi — CID 125498209
6-chloro-4-[(2,6-dichlorophenyl)methyl]-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridine-7-carbonitrile (PubChem CID 125498209) has the molecular formula C20H21Cl3N4OSi and a molecular weight of 467.86 g/mol. Its IUPAC name is 6-chloro-4-[(2,6-dichlorophenyl)methyl]-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridine-7-carbonitrile.
| Compound Name | 6-chloro-4-[(2,6-dichlorophenyl)methyl]-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridine-7-carbonitrile |
|---|---|
| PubChem CID | 125498209 |
| Molecular Formula | C20H21Cl3N4OSi |
| Molecular Weight | 467.86 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 6-chloro-4-[(2,6-dichlorophenyl)methyl]-1-(2-trimethylsilylethoxymethyl)imidazo[4,5-c]pyridine-7-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(Cc3c(Cl)cccc3Cl)nc(Cl)c(C#N)c21 |
| InChI | InChI=1S/C20H21Cl3N4OSi/c1-29(2,3)8-7-28-12-27-11-25-18-17(26-20(23)14(10-24)19(18)27)9-13-15(21)5-4-6-16(13)22/h4-6,11H,7-9,12H2,1-3H3 |
| InChIKey | ZPYBVATVEDBMFI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|