C20H26BrClN4O2Si — CID 178083288
6-bromo-5-chloro-N-[(4-methoxyphenyl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-7-amine (PubChem CID 178083288) has the molecular formula C20H26BrClN4O2Si and a molecular weight of 497.90 g/mol. Its IUPAC name is 6-bromo-5-chloro-N-[(4-methoxyphenyl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 6-bromo-5-chloro-N-[(4-methoxyphenyl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 178083288 |
| Molecular Formula | C20H26BrClN4O2Si |
| Molecular Weight | 497.90 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | 6-bromo-5-chloro-N-[(4-methoxyphenyl)methyl]-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-7-amine |
| SMILES | COc1ccc(CNc2c(Br)c(Cl)nc3c2ncn3COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H26BrClN4O2Si/c1-27-15-7-5-14(6-8-15)11-23-17-16(21)19(22)25-20-18(17)24-12-26(20)13-28-9-10-29(2,3)4/h5-8,12H,9-11,13H2,1-4H3,(H,23,25) |
| InChIKey | YZNRYUGGHDPESV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|