About phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate
phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate (PubChem CID 122179638) has the molecular formula C31H31N3O2
and a molecular weight of 477.61 g/mol. Its IUPAC name is phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate |
| PubChem CID | 122179638 |
| Molecular Formula | C31H31N3O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate |
| SMILES | Cc1c(C#N)c(-c2ccccc2)c(-c2ccccc2)n1CCCCCCNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C31H31N3O2/c1-24-28(23-32)29(25-15-7-4-8-16-25)30(26-17-9-5-10-18-26)34(24)22-14-3-2-13-21-33-31(35)36-27-19-11-6-12-20-27/h4-12,15-20H,2-3,13-14,21-22H2,1H3,(H,33,35) |
| InChIKey | DAJOBKDNNMRORF-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate?
The IUPAC name of phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate (CID 122179638) is phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate.
What is the SMILES notation for phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate?
The canonical SMILES for phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate is Cc1c(C#N)c(-c2ccccc2)c(-c2ccccc2)n1CCCCCCNC(=O)Oc1ccccc1.
What is the InChIKey of phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate?
The InChIKey is DAJOBKDNNMRORF-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H31N3O2/c1-24-28(23-32)29(25-15-7-4-8-16-25)30(26-17-9-5-10-18-26)34(24)22-14-3-2-13-21-33-31(35)36-27-19-11-6-12-20-27/h4-12,15-20H,2-3,13-14,21-22H2,1H3,(H,33,35).
What are the key properties of phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate?
phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate has a molecular weight of 477.61 g/mol, XLogP of 7.35, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[6-(3-cyano-2-methyl-4,5-diphenylpyrrol-1-yl)hexyl]carbamate is sourced from PubChem (CID 122179638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).