C16H28N4O3 — CID 154512455
phenyl N-[5-[2-(methylaminomethylamino)oxyethylamino]pentyl]carbamate (PubChem CID 154512455) has the molecular formula C16H28N4O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is phenyl N-[5-[2-(methylaminomethylamino)oxyethylamino]pentyl]carbamate.
| Compound Name | phenyl N-[5-[2-(methylaminomethylamino)oxyethylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 154512455 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | phenyl N-[5-[2-(methylaminomethylamino)oxyethylamino]pentyl]carbamate |
| SMILES | CNCNOCCNCCCCCNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H28N4O3/c1-17-14-20-22-13-12-18-10-6-3-7-11-19-16(21)23-15-8-4-2-5-9-15/h2,4-5,8-9,17-18,20H,3,6-7,10-14H2,1H3,(H,19,21) |
| InChIKey | OYOQSGAWCUGEFK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|