C29H37N3O2Si — CID 151074126
2-[[5-(3-butylphenyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 151074126) has the molecular formula C29H37N3O2Si and a molecular weight of 487.72 g/mol. Its IUPAC name is 2-[[5-(3-butylphenyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(3-butylphenyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 151074126 |
| Molecular Formula | C29H37N3O2Si |
| Molecular Weight | 487.72 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 2-[[5-(3-butylphenyl)-3-(2-methoxyphenyl)pyrazolo[5,4-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCCCc1cccc(-c2cnc3c(c2)c(-c2ccccc2OC)nn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C29H37N3O2Si/c1-6-7-11-22-12-10-13-23(18-22)24-19-26-28(25-14-8-9-15-27(25)33-2)31-32(29(26)30-20-24)21-34-16-17-35(3,4)5/h8-10,12-15,18-20H,6-7,11,16-17,21H2,1-5H3 |
| InChIKey | MITBNDZYLZLZND-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.72 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|