C21H27ClFN3O3Si — CID 163251302
2-[[6-chloro-3-(2-ethoxy-5-fluoro-4-methoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 163251302) has the molecular formula C21H27ClFN3O3Si and a molecular weight of 452.00 g/mol. Its IUPAC name is 2-[[6-chloro-3-(2-ethoxy-5-fluoro-4-methoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-chloro-3-(2-ethoxy-5-fluoro-4-methoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 163251302 |
| Molecular Formula | C21H27ClFN3O3Si |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[[6-chloro-3-(2-ethoxy-5-fluoro-4-methoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCOc1ncc(F)c(OC)c1-c1cn(COCC[Si](C)(C)C)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C21H27ClFN3O3Si/c1-6-29-21-18(19(27-2)16(23)11-24-21)15-12-26(13-28-9-10-30(3,4)5)20-14(15)7-8-17(22)25-20/h7-8,11-12H,6,9-10,13H2,1-5H3 |
| InChIKey | GVYQBFHQVJFELJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|