C14H10ClF2N3O2S — CID 163251086
[6-chloro-3-(5-fluoro-2,4-dimethoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite (PubChem CID 163251086) has the molecular formula C14H10ClF2N3O2S and a molecular weight of 357.77 g/mol. Its IUPAC name is [6-chloro-3-(5-fluoro-2,4-dimethoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite.
| Compound Name | [6-chloro-3-(5-fluoro-2,4-dimethoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 163251086 |
| Molecular Formula | C14H10ClF2N3O2S |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | [6-chloro-3-(5-fluoro-2,4-dimethoxy-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite |
| SMILES | COc1ncc(F)c(OC)c1-c1cn(SF)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C14H10ClF2N3O2S/c1-21-12-9(16)5-18-14(22-2)11(12)8-6-20(23-17)13-7(8)3-4-10(15)19-13/h3-6H,1-2H3 |
| InChIKey | ZILUCBNHVVUXRN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|