C16H11ClF2N2OS — CID 163251012
[6-chloro-3-(2-cyclopropyloxy-6-fluorophenyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite (PubChem CID 163251012) has the molecular formula C16H11ClF2N2OS and a molecular weight of 352.79 g/mol. Its IUPAC name is [6-chloro-3-(2-cyclopropyloxy-6-fluorophenyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite.
| Compound Name | [6-chloro-3-(2-cyclopropyloxy-6-fluorophenyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 163251012 |
| Molecular Formula | C16H11ClF2N2OS |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | [6-chloro-3-(2-cyclopropyloxy-6-fluorophenyl)pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite |
| SMILES | FSn1cc(-c2c(F)cccc2OC2CC2)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C16H11ClF2N2OS/c17-14-7-6-10-11(8-21(23-19)16(10)20-14)15-12(18)2-1-3-13(15)22-9-4-5-9/h1-3,6-9H,4-5H2 |
| InChIKey | ZKEMVRKBHLJMPD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|