C14H12ClFN4OS — CID 163251580
[6-chloro-3-[2-methoxy-6-(methylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite (PubChem CID 163251580) has the molecular formula C14H12ClFN4OS and a molecular weight of 338.80 g/mol. Its IUPAC name is [6-chloro-3-[2-methoxy-6-(methylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite.
| Compound Name | [6-chloro-3-[2-methoxy-6-(methylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 163251580 |
| Molecular Formula | C14H12ClFN4OS |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | [6-chloro-3-[2-methoxy-6-(methylamino)-3-pyridinyl]pyrrolo[2,3-b]pyridin-1-yl] thiohypofluorite |
| SMILES | CNc1ccc(-c2cn(SF)c3nc(Cl)ccc23)c(OC)n1 |
| InChI | InChI=1S/C14H12ClFN4OS/c1-17-12-6-4-9(14(19-12)21-2)10-7-20(22-16)13-8(10)3-5-11(15)18-13/h3-7H,1-2H3,(H,17,19) |
| InChIKey | MLBNQSGXLROLLB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|